C14H14N2O2 — CID 21071445
N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-3-amine (PubChem CID 21071445) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-3-amine.
| Compound Name | N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 21071445 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-3-amine |
| SMILES | c1cncc(Nc2cccc(C3OCCO3)c2)c1 |
| InChI | InChI=1S/C14H14N2O2/c1-3-11(14-17-7-8-18-14)9-12(4-1)16-13-5-2-6-15-10-13/h1-6,9-10,14,16H,7-8H2 |
| InChIKey | MDXXXBXWYSYQEA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |