C19H14N2O3 — CID 69186236
2,3-bis(furan-3-yl)-5-(pyridin-3-ylamino)phenol (PubChem CID 69186236) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2,3-bis(furan-3-yl)-5-(pyridin-3-ylamino)phenol.
| Compound Name | 2,3-bis(furan-3-yl)-5-(pyridin-3-ylamino)phenol |
|---|---|
| PubChem CID | 69186236 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2,3-bis(furan-3-yl)-5-(pyridin-3-ylamino)phenol |
| SMILES | Oc1cc(Nc2cccnc2)cc(-c2ccoc2)c1-c1ccoc1 |
| InChI | InChI=1S/C19H14N2O3/c22-18-9-16(21-15-2-1-5-20-10-15)8-17(13-3-6-23-11-13)19(18)14-4-7-24-12-14/h1-12,21-22H |
| InChIKey | JBKLWLZNQWXUJA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |