About (4-pyrimidin-4-ylphenyl) formate
(4-pyrimidin-4-ylphenyl) formate (PubChem CID 139536850) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is (4-pyrimidin-4-ylphenyl) formate.
Molecular Properties
| Compound Name | (4-pyrimidin-4-ylphenyl) formate |
| PubChem CID | 139536850 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (4-pyrimidin-4-ylphenyl) formate |
| SMILES | O=COc1ccc(-c2ccncn2)cc1 |
| InChI | InChI=1S/C11H8N2O2/c14-8-15-10-3-1-9(2-4-10)11-5-6-12-7-13-11/h1-8H |
| InChIKey | OJILVXSZGLRNQG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-pyrimidin-4-ylphenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pyrimidin-4-ylphenyl) formate?
The IUPAC name of (4-pyrimidin-4-ylphenyl) formate (CID 139536850) is (4-pyrimidin-4-ylphenyl) formate.
What is the SMILES notation for (4-pyrimidin-4-ylphenyl) formate?
The canonical SMILES for (4-pyrimidin-4-ylphenyl) formate is O=COc1ccc(-c2ccncn2)cc1.
What is the InChIKey of (4-pyrimidin-4-ylphenyl) formate?
The InChIKey is OJILVXSZGLRNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c14-8-15-10-3-1-9(2-4-10)11-5-6-12-7-13-11/h1-8H.
What are the key properties of (4-pyrimidin-4-ylphenyl) formate?
(4-pyrimidin-4-ylphenyl) formate has a molecular weight of 200.20 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pyrimidin-4-ylphenyl) formate is sourced from PubChem (CID 139536850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).