About pyrrolo[3,2-d][1,3]diazepine
pyrrolo[3,2-d][1,3]diazepine (PubChem CID 70359339) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is pyrrolo[3,2-d][1,3]diazepine.
Molecular Properties
| Compound Name | pyrrolo[3,2-d][1,3]diazepine |
| PubChem CID | 70359339 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | pyrrolo[3,2-d][1,3]diazepine |
| SMILES | c1cc2nccc-2ncn1 |
| InChI | InChI=1S/C7H5N3/c1-3-8-5-10-7-2-4-9-6(1)7/h1-5H |
| InChIKey | SNYYDMFDIZYUKD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[3,2-d][1,3]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[3,2-d][1,3]diazepine?
The IUPAC name of pyrrolo[3,2-d][1,3]diazepine (CID 70359339) is pyrrolo[3,2-d][1,3]diazepine.
What is the SMILES notation for pyrrolo[3,2-d][1,3]diazepine?
The canonical SMILES for pyrrolo[3,2-d][1,3]diazepine is c1cc2nccc-2ncn1.
What is the InChIKey of pyrrolo[3,2-d][1,3]diazepine?
The InChIKey is SNYYDMFDIZYUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3/c1-3-8-5-10-7-2-4-9-6(1)7/h1-5H.
What are the key properties of pyrrolo[3,2-d][1,3]diazepine?
pyrrolo[3,2-d][1,3]diazepine has a molecular weight of 131.14 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[3,2-d][1,3]diazepine is sourced from PubChem (CID 70359339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).