C41H19N7 — CID 139538845
5-[4-cyano-2,5-bis(2-cyanocarbazol-9-yl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 139538845) has the molecular formula C41H19N7 and a molecular weight of 609.65 g/mol. Its IUPAC name is 5-[4-cyano-2,5-bis(2-cyanocarbazol-9-yl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[4-cyano-2,5-bis(2-cyanocarbazol-9-yl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139538845 |
| Molecular Formula | C41H19N7 |
| Molecular Weight | 609.65 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | 5-[4-cyano-2,5-bis(2-cyanocarbazol-9-yl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2cc(-n3c4ccccc4c4ccc(C#N)cc43)c(C#N)cc2-n2c3ccccc3c3ccc(C#N)cc32)c1 |
| InChI | InChI=1S/C41H19N7/c42-20-25-9-11-33-31-5-1-3-7-36(31)47(39(33)16-25)38-19-35(29-14-27(22-44)13-28(15-29)23-45)41(18-30(38)24-46)48-37-8-4-2-6-32(37)34-12-10-26(21-43)17-40(34)48/h1-19H |
| InChIKey | SXPMIAKUIRKPNY-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 128.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.65 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |