C25H28ClN3O2 — CID 139541501
N-[3-[5-[(E)-1-chloropent-1-enyl]-6-methyl-3-pyridinyl]phenyl]-1-prop-2-enoylpyrrolidine-2-carboxamide (PubChem CID 139541501) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is N-[3-[5-[(E)-1-chloropent-1-enyl]-6-methyl-3-pyridinyl]phenyl]-1-prop-2-enoylpyrrolidine-2-carboxamide.
| Compound Name | N-[3-[5-[(E)-1-chloropent-1-enyl]-6-methyl-3-pyridinyl]phenyl]-1-prop-2-enoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139541501 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[3-[5-[(E)-1-chloropent-1-enyl]-6-methyl-3-pyridinyl]phenyl]-1-prop-2-enoylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N1CCCC1C(=O)Nc1cccc(-c2cnc(C)c(/C(Cl)=C\CCC)c2)c1 |
| InChI | InChI=1S/C25H28ClN3O2/c1-4-6-11-22(26)21-15-19(16-27-17(21)3)18-9-7-10-20(14-18)28-25(31)23-12-8-13-29(23)24(30)5-2/h5,7,9-11,14-16,23H,2,4,6,8,12-13H2,1,3H3,(H,28,31)/b22-11+ |
| InChIKey | IFUKKBLHBCKQMO-SSDVNMTOSA-N |
| XLogP | 5.55 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|