C15H15N3O3 — CID 172889376
(2S)-N-(3-methyl-1,2-benzoxazol-5-yl)-1-prop-2-enoylazetidine-2-carboxamide (PubChem CID 172889376) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2S)-N-(3-methyl-1,2-benzoxazol-5-yl)-1-prop-2-enoylazetidine-2-carboxamide.
| Compound Name | (2S)-N-(3-methyl-1,2-benzoxazol-5-yl)-1-prop-2-enoylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 172889376 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2S)-N-(3-methyl-1,2-benzoxazol-5-yl)-1-prop-2-enoylazetidine-2-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H]1C(=O)Nc1ccc2onc(C)c2c1 |
| InChI | InChI=1S/C15H15N3O3/c1-3-14(19)18-7-6-12(18)15(20)16-10-4-5-13-11(8-10)9(2)17-21-13/h3-5,8,12H,1,6-7H2,2H3,(H,16,20)/t12-/m0/s1 |
| InChIKey | VMYPYHQWYLNBFC-LBPRGKRZSA-N |
| XLogP | 1.86 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|