C17H17N3O3 — CID 172889369
(2S)-N-(3-benzyl-1,2-oxazol-5-yl)-1-prop-2-enoylazetidine-2-carboxamide (PubChem CID 172889369) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2S)-N-(3-benzyl-1,2-oxazol-5-yl)-1-prop-2-enoylazetidine-2-carboxamide.
| Compound Name | (2S)-N-(3-benzyl-1,2-oxazol-5-yl)-1-prop-2-enoylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 172889369 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2S)-N-(3-benzyl-1,2-oxazol-5-yl)-1-prop-2-enoylazetidine-2-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H]1C(=O)Nc1cc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C17H17N3O3/c1-2-16(21)20-9-8-14(20)17(22)18-15-11-13(19-23-15)10-12-6-4-3-5-7-12/h2-7,11,14H,1,8-10H2,(H,18,22)/t14-/m0/s1 |
| InChIKey | PWJPQIOECHZVQG-AWEZNQCLSA-N |
| XLogP | 1.99 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|