C15H18N3OPS — CID 139541717
N-(4-ethyl-4-aza-5-phosphaspiro[2.3]hexan-6-yl)-2-methyl-1,3-benzothiazole-5-carboxamide (PubChem CID 139541717) has the molecular formula C15H18N3OPS and a molecular weight of 319.37 g/mol. Its IUPAC name is N-(4-ethyl-4-aza-5-phosphaspiro[2.3]hexan-6-yl)-2-methyl-1,3-benzothiazole-5-carboxamide.
| Compound Name | N-(4-ethyl-4-aza-5-phosphaspiro[2.3]hexan-6-yl)-2-methyl-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 139541717 |
| Molecular Formula | C15H18N3OPS |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-(4-ethyl-4-aza-5-phosphaspiro[2.3]hexan-6-yl)-2-methyl-1,3-benzothiazole-5-carboxamide |
| SMILES | CCN1PC(NC(=O)c2ccc3sc(C)nc3c2)C12CC2 |
| InChI | InChI=1S/C15H18N3OPS/c1-3-18-15(6-7-15)14(20-18)17-13(19)10-4-5-12-11(8-10)16-9(2)21-12/h4-5,8,14,20H,3,6-7H2,1-2H3,(H,17,19) |
| InChIKey | SJAXBMKISFDFCO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|