C26H30FNO3S — CID 139542161
ethyl (E)-3-[1-[3-fluoro-4-[[(3S,6R)-3-methyl-1-oxo-6-phenylthiazinan-2-yl]methyl]phenyl]cyclopropyl]prop-2-enoate (PubChem CID 139542161) has the molecular formula C26H30FNO3S and a molecular weight of 455.60 g/mol. Its IUPAC name is ethyl (E)-3-[1-[3-fluoro-4-[[(3S,6R)-3-methyl-1-oxo-6-phenylthiazinan-2-yl]methyl]phenyl]cyclopropyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1-[3-fluoro-4-[[(3S,6R)-3-methyl-1-oxo-6-phenylthiazinan-2-yl]methyl]phenyl]cyclopropyl]prop-2-enoate |
|---|---|
| PubChem CID | 139542161 |
| Molecular Formula | C26H30FNO3S |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | ethyl (E)-3-[1-[3-fluoro-4-[[(3S,6R)-3-methyl-1-oxo-6-phenylthiazinan-2-yl]methyl]phenyl]cyclopropyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1(c2ccc(CN3[C@@H](C)CC[C@H](c4ccccc4)S3=O)c(F)c2)CC1 |
| InChI | InChI=1S/C26H30FNO3S/c1-3-31-25(29)13-14-26(15-16-26)22-11-10-21(23(27)17-22)18-28-19(2)9-12-24(32(28)30)20-7-5-4-6-8-20/h4-8,10-11,13-14,17,19,24H,3,9,12,15-16,18H2,1-2H3/b14-13+/t19-,24+,32?/m0/s1 |
| InChIKey | WAEDQNVCGXHIMX-MCWFVAMISA-N |
| XLogP | 5.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|