C38H43N5O6 — CID 139542542
N-[3-[[2-methoxy-4-methyl-5-(methylamino)phenoxy]methyl]-5-[(8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-9-yl)oxymethyl]phenyl]-2-(methylamino)propanamide (PubChem CID 139542542) has the molecular formula C38H43N5O6 and a molecular weight of 665.79 g/mol. Its IUPAC name is N-[3-[[2-methoxy-4-methyl-5-(methylamino)phenoxy]methyl]-5-[(8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-9-yl)oxymethyl]phenyl]-2-(methylamino)propanamide.
| Compound Name | N-[3-[[2-methoxy-4-methyl-5-(methylamino)phenoxy]methyl]-5-[(8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-9-yl)oxymethyl]phenyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 139542542 |
| Molecular Formula | C38H43N5O6 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.32 |
| IUPAC Name | N-[3-[[2-methoxy-4-methyl-5-(methylamino)phenoxy]methyl]-5-[(8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-9-yl)oxymethyl]phenyl]-2-(methylamino)propanamide |
| SMILES | CNc1cc(OCc2cc(COc3cc4c(cc3OC)C(=O)N3c5ccccc5CC3CN4)cc(NC(=O)C(C)NC)c2)c(OC)cc1C |
| InChI | InChI=1S/C38H43N5O6/c1-22-11-33(46-5)35(17-30(22)40-4)48-20-24-12-25(14-27(13-24)42-37(44)23(2)39-3)21-49-36-18-31-29(16-34(36)47-6)38(45)43-28(19-41-31)15-26-9-7-8-10-32(26)43/h7-14,16-18,23,28,39-41H,15,19-21H2,1-6H3,(H,42,44) |
| InChIKey | RERGWNXLOASSJU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 122.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|