C48H48N4O9 — CID 59440256
methyl 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]pentanoate (PubChem CID 59440256) has the molecular formula C48H48N4O9 and a molecular weight of 824.93 g/mol. Its IUPAC name is methyl 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]pentanoate.
| Compound Name | methyl 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 59440256 |
| Molecular Formula | C48H48N4O9 |
| Molecular Weight | 824.93 g/mol |
| Exact Mass | 824.34 |
| IUPAC Name | methyl 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]pentanoate |
| SMILES | COC(=O)CCCCOc1cc(COc2cc3c(cc2OC)C(=O)N2c4ccccc4C[C@H]2CN3)cc(COc2cc3c(cc2OC)C(=O)N2c4ccccc4C[C@H]2CN3)c1 |
| InChI | InChI=1S/C48H48N4O9/c1-56-42-21-36-38(49-25-33-19-31-10-4-6-12-40(31)51(33)47(36)54)23-44(42)60-27-29-16-30(18-35(17-29)59-15-9-8-14-46(53)58-3)28-61-45-24-39-37(22-43(45)57-2)48(55)52-34(26-50-39)20-32-11-5-7-13-41(32)52/h4-7,10-13,16-18,21-24,33-34,49-50H,8-9,14-15,19-20,25-28H2,1-3H3/t33-,34-/m0/s1 |
| InChIKey | WEDVQVMOTWMRGW-HEVIKAOCSA-N |
| XLogP | 7.58 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.93 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|