C27H25NO4S2 — CID 139542633
1-[4-(4-hydroxy-2-methylbutan-2-yl)oxyphenyl]-3,4-bis(phenylsulfanyl)pyrrole-2,5-dione (PubChem CID 139542633) has the molecular formula C27H25NO4S2 and a molecular weight of 491.63 g/mol. Its IUPAC name is 1-[4-(4-hydroxy-2-methylbutan-2-yl)oxyphenyl]-3,4-bis(phenylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 1-[4-(4-hydroxy-2-methylbutan-2-yl)oxyphenyl]-3,4-bis(phenylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139542633 |
| Molecular Formula | C27H25NO4S2 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 1-[4-(4-hydroxy-2-methylbutan-2-yl)oxyphenyl]-3,4-bis(phenylsulfanyl)pyrrole-2,5-dione |
| SMILES | CC(C)(CCO)Oc1ccc(N2C(=O)C(Sc3ccccc3)=C(Sc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H25NO4S2/c1-27(2,17-18-29)32-20-15-13-19(14-16-20)28-25(30)23(33-21-9-5-3-6-10-21)24(26(28)31)34-22-11-7-4-8-12-22/h3-16,29H,17-18H2,1-2H3 |
| InChIKey | MUAWSYGVOXMKDN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|