C40H58O11 — CID 139543809
2-[(1S,7S,18R,19R,28S,30R,36R)-19,36-dimethoxy-12-methyl-6,13-dimethylidene-22-oxo-17,31,34,35,38,39,40-heptaoxaoctacyclo[27.5.1.11,32.14,7.110,14.124,28.130,33.016,20]tetracontan-18-yl]acetaldehyde (PubChem CID 139543809) has the molecular formula C40H58O11 and a molecular weight of 714.89 g/mol. Its IUPAC name is 2-[(1S,7S,18R,19R,28S,30R,36R)-19,36-dimethoxy-12-methyl-6,13-dimethylidene-22-oxo-17,31,34,35,38,39,40-heptaoxaoctacyclo[27.5.1.11,32.14,7.110,14.124,28.130,33.016,20]tetracontan-18-yl]acetaldehyde.
| Compound Name | 2-[(1S,7S,18R,19R,28S,30R,36R)-19,36-dimethoxy-12-methyl-6,13-dimethylidene-22-oxo-17,31,34,35,38,39,40-heptaoxaoctacyclo[27.5.1.11,32.14,7.110,14.124,28.130,33.016,20]tetracontan-18-yl]acetaldehyde |
|---|---|
| PubChem CID | 139543809 |
| Molecular Formula | C40H58O11 |
| Molecular Weight | 714.89 g/mol |
| Exact Mass | 714.40 |
| IUPAC Name | 2-[(1S,7S,18R,19R,28S,30R,36R)-19,36-dimethoxy-12-methyl-6,13-dimethylidene-22-oxo-17,31,34,35,38,39,40-heptaoxaoctacyclo[27.5.1.11,32.14,7.110,14.124,28.130,33.016,20]tetracontan-18-yl]acetaldehyde |
| SMILES | C=C1CC2CCC34CC5OC(C(O3)C3CCCC(CC(=O)CC6C(CC7OC(CCC1O2)CC(C)C7=C)OC(CC=O)C6OC)O3)C(OC)C5O4 |
| InChI | InChI=1S/C40H58O11/c1-21-15-26-9-10-29-22(2)16-27(45-29)11-13-40-20-34-37(51-40)38(44-5)39(49-34)36(50-40)30-8-6-7-25(46-30)17-24(42)18-28-33(19-32(47-26)23(21)3)48-31(12-14-41)35(28)43-4/h14,21,25-39H,2-3,6-13,15-20H2,1,4-5H3 |
| InChIKey | SGTVDMTUFUETFN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|