C68H48N6S — CID 139545102
2-[2,6-bis[4-(3,6-dimethylcarbazol-9-yl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-benzothiazole (PubChem CID 139545102) has the molecular formula C68H48N6S and a molecular weight of 981.24 g/mol. Its IUPAC name is 2-[2,6-bis[4-(3,6-dimethylcarbazol-9-yl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[2,6-bis[4-(3,6-dimethylcarbazol-9-yl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 139545102 |
| Molecular Formula | C68H48N6S |
| Molecular Weight | 981.24 g/mol |
| Exact Mass | 980.37 |
| IUPAC Name | 2-[2,6-bis[4-(3,6-dimethylcarbazol-9-yl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-benzothiazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3ccc(-n4c5ccc(C)cc5c5cc(C)ccc54)cc3)c2-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C68H48N6S/c1-41-19-31-59-54(35-41)55-36-42(2)20-32-60(55)73(59)50-27-23-45(24-28-50)52-39-49(67-71-65(47-13-7-5-8-14-47)70-66(72-67)48-15-9-6-10-16-48)40-53(64(52)68-69-58-17-11-12-18-63(58)75-68)46-25-29-51(30-26-46)74-61-33-21-43(3)37-56(61)57-38-44(4)22-34-62(57)74/h5-40H,1-4H3 |
| InChIKey | JXAVYRYRKBDJKJ-UHFFFAOYSA-N |
| XLogP | 17.91 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.24 |
| LogP ≤ 5 | 17.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |