C20H32N2O8 — CID 139546170
methyl (2S,4R)-1-[2-[3-(2,2-diethoxyethoxy)-1,2-oxazol-5-yl]-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 139546170) has the molecular formula C20H32N2O8 and a molecular weight of 428.48 g/mol. Its IUPAC name is methyl (2S,4R)-1-[2-[3-(2,2-diethoxyethoxy)-1,2-oxazol-5-yl]-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-[2-[3-(2,2-diethoxyethoxy)-1,2-oxazol-5-yl]-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139546170 |
| Molecular Formula | C20H32N2O8 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | methyl (2S,4R)-1-[2-[3-(2,2-diethoxyethoxy)-1,2-oxazol-5-yl]-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCOC(COc1cc(C(C(=O)N2C[C@H](O)C[C@H]2C(=O)OC)C(C)C)on1)OCC |
| InChI | InChI=1S/C20H32N2O8/c1-6-27-17(28-7-2)11-29-16-9-15(30-21-16)18(12(3)4)19(24)22-10-13(23)8-14(22)20(25)26-5/h9,12-14,17-18,23H,6-8,10-11H2,1-5H3/t13-,14+,18?/m1/s1 |
| InChIKey | ZJWWILXGWAGLDH-RMAOKOMNSA-N |
| XLogP | 1.33 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|