C27H36N4O6 — CID 169116809
N-[(4-cyanophenyl)methyl]-1-[2-[3-(2,2-diethoxyethoxy)-1,2-oxazol-5-yl]-3-methylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 169116809) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-1-[2-[3-(2,2-diethoxyethoxy)-1,2-oxazol-5-yl]-3-methylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-1-[2-[3-(2,2-diethoxyethoxy)-1,2-oxazol-5-yl]-3-methylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169116809 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-1-[2-[3-(2,2-diethoxyethoxy)-1,2-oxazol-5-yl]-3-methylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCOC(COc1cc(C(C(=O)N2CCCC2C(=O)NCc2ccc(C#N)cc2)C(C)C)on1)OCC |
| InChI | InChI=1S/C27H36N4O6/c1-5-34-24(35-6-2)17-36-23-14-22(37-30-23)25(18(3)4)27(33)31-13-7-8-21(31)26(32)29-16-20-11-9-19(15-28)10-12-20/h9-12,14,18,21,24-25H,5-8,13,16-17H2,1-4H3,(H,29,32) |
| InChIKey | WJUNILLIRRVBAR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|