C15H13F3N6O — CID 139546635
(2E)-2-hydrazinylidene-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pyridin-3-amine (PubChem CID 139546635) has the molecular formula C15H13F3N6O and a molecular weight of 350.30 g/mol. Its IUPAC name is (2E)-2-hydrazinylidene-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pyridin-3-amine.
| Compound Name | (2E)-2-hydrazinylidene-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 139546635 |
| Molecular Formula | C15H13F3N6O |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (2E)-2-hydrazinylidene-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pyridin-3-amine |
| SMILES | N/N=c1\c(N)cccn1Cc1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H13F3N6O/c16-15(17,18)14-21-12(23-25-14)10-5-3-9(4-6-10)8-24-7-1-2-11(19)13(24)22-20/h1-7H,8,19-20H2/b22-13+ |
| InChIKey | IWNYVANPGNEWMX-LPYMAVHISA-N |
| XLogP | 1.96 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|