About 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane
4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane (PubChem CID 139548143) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane.
Analyze 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane?
The IUPAC name of 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane (CID 139548143) is 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane.
What is the SMILES notation for 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane?
The canonical SMILES for 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane is CC1NC2CN(C(C)C)CC23CC13.
What is the InChIKey of 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane?
The InChIKey is AXNZXNMVGHJKOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-7(2)13-5-10-11(6-13)4-9(11)8(3)12-10/h7-10,12H,4-6H2,1-3H3.
What are the key properties of 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane?
4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane has a molecular weight of 180.29 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-8-propan-2-yl-5,8-diazatricyclo[4.3.0.01,3]nonane is sourced from PubChem (CID 139548143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).