C11H26N2 — CID 168910991
(3S)-3,5-dimethyl-1-propan-2-ylpiperazine;ethane (PubChem CID 168910991) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is (3S)-3,5-dimethyl-1-propan-2-ylpiperazine;ethane.
| Compound Name | (3S)-3,5-dimethyl-1-propan-2-ylpiperazine;ethane |
|---|---|
| PubChem CID | 168910991 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | (3S)-3,5-dimethyl-1-propan-2-ylpiperazine;ethane |
| SMILES | CC.CC1CN(C(C)C)C[C@H](C)N1 |
| InChI | InChI=1S/C9H20N2.C2H6/c1-7(2)11-5-8(3)10-9(4)6-11;1-2/h7-10H,5-6H2,1-4H3;1-2H3/t8-,9?;/m0./s1 |
| InChIKey | GJLCQHLWGOXRLZ-GUORDYTPSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |