C9H17FO — CID 139548437
(4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol (PubChem CID 139548437) has the molecular formula C9H17FO and a molecular weight of 160.23 g/mol. Its IUPAC name is (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol.
| Compound Name | (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol |
|---|---|
| PubChem CID | 139548437 |
| Molecular Formula | C9H17FO |
| Molecular Weight | 160.23 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol |
| SMILES | C=CC(O)(F)[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C9H17FO/c1-6-9(10,11)7(2)8(3,4)5/h6-7,11H,1H2,2-5H3/t7-,9?/m1/s1 |
| InChIKey | MFSMHWIYVSRYEZ-YOXFSPIKSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|