About (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol
(4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol (PubChem CID 139548437) has the molecular formula C9H17FO
and a molecular weight of 160.23 g/mol. Its IUPAC name is (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol.
Molecular Properties
| Compound Name | (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol |
| PubChem CID | 139548437 |
| Molecular Formula | C9H17FO |
| Molecular Weight | 160.23 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol |
| SMILES | C=CC(O)(F)[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C9H17FO/c1-6-9(10,11)7(2)8(3,4)5/h6-7,11H,1H2,2-5H3/t7-,9?/m1/s1 |
| InChIKey | MFSMHWIYVSRYEZ-YOXFSPIKSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol?
The IUPAC name of (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol (CID 139548437) is (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol.
What is the SMILES notation for (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol?
The canonical SMILES for (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol is C=CC(O)(F)[C@H](C)C(C)(C)C.
What is the InChIKey of (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol?
The InChIKey is MFSMHWIYVSRYEZ-YOXFSPIKSA-N. The full InChI is InChI=1S/C9H17FO/c1-6-9(10,11)7(2)8(3,4)5/h6-7,11H,1H2,2-5H3/t7-,9?/m1/s1.
What are the key properties of (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol?
(4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol has a molecular weight of 160.23 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-fluoro-4,5,5-trimethylhex-1-en-3-ol is sourced from PubChem (CID 139548437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).