C10H19N — CID 139549250
(3Z,6Z)-N-methylnona-3,6-dien-2-amine (PubChem CID 139549250) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (3Z,6Z)-N-methylnona-3,6-dien-2-amine.
| Compound Name | (3Z,6Z)-N-methylnona-3,6-dien-2-amine |
|---|---|
| PubChem CID | 139549250 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (3Z,6Z)-N-methylnona-3,6-dien-2-amine |
| SMILES | CC/C=C\C/C=C\C(C)NC |
| InChI | InChI=1S/C10H19N/c1-4-5-6-7-8-9-10(2)11-3/h5-6,8-11H,4,7H2,1-3H3/b6-5-,9-8- |
| InChIKey | XEFMXNKOCSOBOX-AFJQJTPPSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|