C18H20F3N3O — CID 139550677
4-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-5-[4-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 139550677) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is 4-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-5-[4-(trifluoromethyl)phenyl]pyridin-2-amine.
| Compound Name | 4-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-5-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 139550677 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-5-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | CO[C@H]1CCN(Cc2cc(N)ncc2-c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H20F3N3O/c1-25-15-6-7-24(11-15)10-13-8-17(22)23-9-16(13)12-2-4-14(5-3-12)18(19,20)21/h2-5,8-9,15H,6-7,10-11H2,1H3,(H2,22,23)/t15-/m0/s1 |
| InChIKey | AFLCOYIFEUSHHD-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |