C53H38N6 — CID 139551278
2-[4-[7-[4-(1-methyl-2,6-diphenyl-2H-1,3,5-triazin-4-yl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 139551278) has the molecular formula C53H38N6 and a molecular weight of 758.93 g/mol. Its IUPAC name is 2-[4-[7-[4-(1-methyl-2,6-diphenyl-2H-1,3,5-triazin-4-yl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[7-[4-(1-methyl-2,6-diphenyl-2H-1,3,5-triazin-4-yl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 139551278 |
| Molecular Formula | C53H38N6 |
| Molecular Weight | 758.93 g/mol |
| Exact Mass | 758.32 |
| IUPAC Name | 2-[4-[7-[4-(1-methyl-2,6-diphenyl-2H-1,3,5-triazin-4-yl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CN1C(c2ccccc2)=NC(c2ccc(-c3ccc4ccc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)cc4c3)cc2)=NC1c1ccccc1 |
| InChI | InChI=1S/C53H38N6/c1-59-52(43-18-10-4-11-19-43)57-51(58-53(59)44-20-12-5-13-21-44)42-30-24-37(25-31-42)46-33-27-38-26-32-45(34-47(38)35-46)36-22-28-41(29-23-36)50-55-48(39-14-6-2-7-15-39)54-49(56-50)40-16-8-3-9-17-40/h2-35,52H,1H3 |
| InChIKey | HXVCGAFEFKENQY-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.93 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |