C46H40N6 — CID 174298006
4-cyclohexa-1,5-dien-1-yl-1-methyl-6-phenyl-2-[4-[7-[4-(5-phenyl-1,2,4-triazolidin-3-yl)phenyl]naphthalen-2-yl]phenyl]-2H-1,3,5-triazine (PubChem CID 174298006) has the molecular formula C46H40N6 and a molecular weight of 676.87 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-1-methyl-6-phenyl-2-[4-[7-[4-(5-phenyl-1,2,4-triazolidin-3-yl)phenyl]naphthalen-2-yl]phenyl]-2H-1,3,5-triazine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-1-methyl-6-phenyl-2-[4-[7-[4-(5-phenyl-1,2,4-triazolidin-3-yl)phenyl]naphthalen-2-yl]phenyl]-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 174298006 |
| Molecular Formula | C46H40N6 |
| Molecular Weight | 676.87 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-1-methyl-6-phenyl-2-[4-[7-[4-(5-phenyl-1,2,4-triazolidin-3-yl)phenyl]naphthalen-2-yl]phenyl]-2H-1,3,5-triazine |
| SMILES | CN1C(c2ccccc2)=NC(C2=CCCC=C2)=NC1c1ccc(-c2ccc3ccc(-c4ccc(C5NNC(c6ccccc6)N5)cc4)cc3c2)cc1 |
| InChI | InChI=1S/C46H40N6/c1-52-45(37-15-9-4-10-16-37)48-42(34-11-5-2-6-12-34)49-46(52)38-25-19-32(20-26-38)40-28-22-33-21-27-39(29-41(33)30-40)31-17-23-36(24-18-31)44-47-43(50-51-44)35-13-7-3-8-14-35/h3-5,7-30,43-44,46-47,50-51H,2,6H2,1H3 |
| InChIKey | JMYHUOULEUQIIG-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.87 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |