C12H25NO — CID 139552020
(E,2R)-2-aminododec-4-en-1-ol (PubChem CID 139552020) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (E,2R)-2-aminododec-4-en-1-ol.
| Compound Name | (E,2R)-2-aminododec-4-en-1-ol |
|---|---|
| PubChem CID | 139552020 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (E,2R)-2-aminododec-4-en-1-ol |
| SMILES | CCCCCCC/C=C/C[C@@H](N)CO |
| InChI | InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-10-12(13)11-14/h8-9,12,14H,2-7,10-11,13H2,1H3/b9-8+/t12-/m1/s1 |
| InChIKey | NJLZLPJIIWJOQC-IDVQTMNDSA-N |
| XLogP | 2.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|