C26H30N4O2 — CID 139553479
(2S,4R)-N-[[4-(aminomethyl)phenyl]methyl]-4-cyano-1-[2-(2-phenylethyl)but-3-enoyl]pyrrolidine-2-carboxamide (PubChem CID 139553479) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is (2S,4R)-N-[[4-(aminomethyl)phenyl]methyl]-4-cyano-1-[2-(2-phenylethyl)but-3-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[[4-(aminomethyl)phenyl]methyl]-4-cyano-1-[2-(2-phenylethyl)but-3-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139553479 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (2S,4R)-N-[[4-(aminomethyl)phenyl]methyl]-4-cyano-1-[2-(2-phenylethyl)but-3-enoyl]pyrrolidine-2-carboxamide |
| SMILES | C=CC(CCc1ccccc1)C(=O)N1C[C@H](C#N)C[C@H]1C(=O)NCc1ccc(CN)cc1 |
| InChI | InChI=1S/C26H30N4O2/c1-2-23(13-12-19-6-4-3-5-7-19)26(32)30-18-22(16-28)14-24(30)25(31)29-17-21-10-8-20(15-27)9-11-21/h2-11,22-24H,1,12-15,17-18,27H2,(H,29,31)/t22-,23?,24-/m0/s1 |
| InChIKey | ZRMBDLKCAXDELR-OTKIHZFJSA-N |
| XLogP | 2.94 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|