C28H30F6N6O6 — CID 175811485
(2S,4S)-1-[(2R)-2-amino-4-phenylbutanoyl]-N-[(4-carbamimidoylphenyl)methyl]-4-cyanopyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175811485) has the molecular formula C28H30F6N6O6 and a molecular weight of 660.57 g/mol. Its IUPAC name is (2S,4S)-1-[(2R)-2-amino-4-phenylbutanoyl]-N-[(4-carbamimidoylphenyl)methyl]-4-cyanopyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,4S)-1-[(2R)-2-amino-4-phenylbutanoyl]-N-[(4-carbamimidoylphenyl)methyl]-4-cyanopyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175811485 |
| Molecular Formula | C28H30F6N6O6 |
| Molecular Weight | 660.57 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | (2S,4S)-1-[(2R)-2-amino-4-phenylbutanoyl]-N-[(4-carbamimidoylphenyl)methyl]-4-cyanopyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2C[C@H](C#N)CN2C(=O)[C@H](N)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N6O2.2C2HF3O2/c25-13-18-12-21(23(31)29-14-17-6-9-19(10-7-17)22(27)28)30(15-18)24(32)20(26)11-8-16-4-2-1-3-5-16;2*3-2(4,5)1(6)7/h1-7,9-10,18,20-21H,8,11-12,14-15,26H2,(H3,27,28)(H,29,31);2*(H,6,7)/t18-,20-,21+;;/m1../s1 |
| InChIKey | KJNBGFSQHDLZPN-KCGNQKJDSA-N |
| XLogP | 2.55 |
| TPSA | 223.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|