C36H39F3N4O2 — CID 139553503
4-[4-[[4,4-dimethyl-2-[5-methyl-5-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzaldehyde (PubChem CID 139553503) has the molecular formula C36H39F3N4O2 and a molecular weight of 616.73 g/mol. Its IUPAC name is 4-[4-[[4,4-dimethyl-2-[5-methyl-5-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzaldehyde.
| Compound Name | 4-[4-[[4,4-dimethyl-2-[5-methyl-5-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzaldehyde |
|---|---|
| PubChem CID | 139553503 |
| Molecular Formula | C36H39F3N4O2 |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | 4-[4-[[4,4-dimethyl-2-[5-methyl-5-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzaldehyde |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C=O)c(Oc4cnc5[nH]ccc5c4)c3)CC2)=C(C2=CC=CC(C)(C(F)(F)F)C=C2)C1 |
| InChI | InChI=1S/C36H39F3N4O2/c1-34(2)12-8-27(31(21-34)25-5-4-11-35(3,13-9-25)36(37,38)39)23-42-15-17-43(18-16-42)29-7-6-28(24-44)32(20-29)45-30-19-26-10-14-40-33(26)41-22-30/h4-7,9-11,13-14,19-20,22,24H,8,12,15-18,21,23H2,1-3H3,(H,40,41) |
| InChIKey | HRENUMPJLXQQQL-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|