C18H28N2O2 — CID 139553819
6-cyclohexyl-3-[(cyclopentylamino)methyl]-1-hydroxy-4-methylpyridin-2-one (PubChem CID 139553819) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 6-cyclohexyl-3-[(cyclopentylamino)methyl]-1-hydroxy-4-methylpyridin-2-one.
| Compound Name | 6-cyclohexyl-3-[(cyclopentylamino)methyl]-1-hydroxy-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 139553819 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 6-cyclohexyl-3-[(cyclopentylamino)methyl]-1-hydroxy-4-methylpyridin-2-one |
| SMILES | Cc1cc(C2CCCCC2)n(O)c(=O)c1CNC1CCCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-13-11-17(14-7-3-2-4-8-14)20(22)18(21)16(13)12-19-15-9-5-6-10-15/h11,14-15,19,22H,2-10,12H2,1H3 |
| InChIKey | IDCOEROKAMDSSY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|