C16H28N2O3 — CID 162221947
6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;2-(ethylamino)ethanol (PubChem CID 162221947) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;2-(ethylamino)ethanol.
| Compound Name | 6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;2-(ethylamino)ethanol |
|---|---|
| PubChem CID | 162221947 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;2-(ethylamino)ethanol |
| SMILES | CCNCCO.Cc1cc(C2CCCCC2)n(O)c(=O)c1 |
| InChI | InChI=1S/C12H17NO2.C4H11NO/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;1-2-5-3-4-6/h7-8,10,15H,2-6H2,1H3;5-6H,2-4H2,1H3 |
| InChIKey | ZUFZDJOVMCWJIP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|