C26H41N3O5 — CID 139036825
6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium (PubChem CID 139036825) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is 6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium.
| Compound Name | 6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium |
|---|---|
| PubChem CID | 139036825 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | 6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium |
| SMILES | Cc1cc(C2CCCCC2)n(O)c(=O)c1.Cc1cc(C2CCCCC2)n([O-])c(=O)c1.[NH3+]CCO |
| InChI | InChI=1S/C12H17NO2.C12H16NO2.C2H7NO/c2*1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4/h7-8,10,15H,2-6H2,1H3;7-8,10H,2-6H2,1H3;4H,1-3H2/q;-1;/p+1 |
| InChIKey | UMDFIGNYYISSEE-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|