C14H26N2O4 — CID 172643597
2-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;hydrate (PubChem CID 172643597) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;hydrate.
| Compound Name | 2-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;hydrate |
|---|---|
| PubChem CID | 172643597 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one;hydrate |
| SMILES | Cc1cc(C2CCCCC2)n(O)c(=O)c1.NCCO.O |
| InChI | InChI=1S/C12H17NO2.C2H7NO.H2O/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4;/h7-8,10,15H,2-6H2,1H3;4H,1-3H2;1H2 |
| InChIKey | PRMIYMYZKZXMFS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|