C14H24N2O3 — CID 57465385
1-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one (PubChem CID 57465385) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one.
| Compound Name | 1-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 57465385 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one |
| SMILES | CC(N)O.Cc1cc(C2CCCCC2)n(O)c(=O)c1 |
| InChI | InChI=1S/C12H17NO2.C2H7NO/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;1-2(3)4/h7-8,10,15H,2-6H2,1H3;2,4H,3H2,1H3 |
| InChIKey | IHJQJCYIVVRVKX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|