C18H34N2O4 — CID 19863212
2-(2-hydroxyethylamino)ethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one (PubChem CID 19863212) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one.
| Compound Name | 2-(2-hydroxyethylamino)ethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
|---|---|
| PubChem CID | 19863212 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
| SMILES | Cc1cc(CC(C)CC(C)(C)C)n(O)c(=O)c1.OCCNCCO |
| InChI | InChI=1S/C14H23NO2.C4H11NO2/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5;6-3-1-5-2-4-7/h6,8,11,17H,7,9H2,1-5H3;5-7H,1-4H2 |
| InChIKey | UMJGKWWLODKJSV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|