C23H37N5O5 — CID 139553896
(6S,9S,12S)-7-hydroxy-6-[(1R)-1-hydroxyethyl]-12-[(4-hydroxyphenyl)methyl]-9-(2-methylpropyl)-2,5,8,11,14-pentazaspiro[3.11]pentadecane-10,13-dione (PubChem CID 139553896) has the molecular formula C23H37N5O5 and a molecular weight of 463.58 g/mol. Its IUPAC name is (6S,9S,12S)-7-hydroxy-6-[(1R)-1-hydroxyethyl]-12-[(4-hydroxyphenyl)methyl]-9-(2-methylpropyl)-2,5,8,11,14-pentazaspiro[3.11]pentadecane-10,13-dione.
| Compound Name | (6S,9S,12S)-7-hydroxy-6-[(1R)-1-hydroxyethyl]-12-[(4-hydroxyphenyl)methyl]-9-(2-methylpropyl)-2,5,8,11,14-pentazaspiro[3.11]pentadecane-10,13-dione |
|---|---|
| PubChem CID | 139553896 |
| Molecular Formula | C23H37N5O5 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (6S,9S,12S)-7-hydroxy-6-[(1R)-1-hydroxyethyl]-12-[(4-hydroxyphenyl)methyl]-9-(2-methylpropyl)-2,5,8,11,14-pentazaspiro[3.11]pentadecane-10,13-dione |
| SMILES | CC(C)C[C@@H]1NC(O)[C@H]([C@@H](C)O)NC2(CNC2)CNC(=O)[C@H](Cc2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C23H37N5O5/c1-13(2)8-17-21(32)26-18(9-15-4-6-16(30)7-5-15)20(31)25-12-23(10-24-11-23)28-19(14(3)29)22(33)27-17/h4-7,13-14,17-19,22,24,27-30,33H,8-12H2,1-3H3,(H,25,31)(H,26,32)/t14-,17+,18+,19+,22?/m1/s1 |
| InChIKey | BSGYQZPVRFELPI-YUEWOODKSA-N |
| XLogP | -1.45 |
| TPSA | 154.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |