C32H44N6O6 — CID 177445405
(15S)-12-benzyl-6-[(4-hydroxyphenyl)methyl]-15-methyl-9-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclononadecane-2,5,8,11,14-pentone (PubChem CID 177445405) has the molecular formula C32H44N6O6 and a molecular weight of 608.74 g/mol. Its IUPAC name is (15S)-12-benzyl-6-[(4-hydroxyphenyl)methyl]-15-methyl-9-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclononadecane-2,5,8,11,14-pentone.
| Compound Name | (15S)-12-benzyl-6-[(4-hydroxyphenyl)methyl]-15-methyl-9-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclononadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 177445405 |
| Molecular Formula | C32H44N6O6 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | (15S)-12-benzyl-6-[(4-hydroxyphenyl)methyl]-15-methyl-9-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclononadecane-2,5,8,11,14-pentone |
| SMILES | CC(C)CC1NC(=O)C(Cc2ccccc2)NC(=O)[C@H](C)NCCCNC(=O)CNC(=O)C(Cc2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C32H44N6O6/c1-20(2)16-25-31(43)38-26(18-23-10-12-24(39)13-11-23)30(42)35-19-28(40)34-15-7-14-33-21(3)29(41)36-27(32(44)37-25)17-22-8-5-4-6-9-22/h4-6,8-13,20-21,25-27,33,39H,7,14-19H2,1-3H3,(H,34,40)(H,35,42)(H,36,41)(H,37,44)(H,38,43)/t21-,25?,26?,27?/m0/s1 |
| InChIKey | NTLDUDLWIAWVDH-NMZQXGDBSA-N |
| XLogP | 0.29 |
| TPSA | 177.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |