C10H18N2O3 — CID 139553940
(2R)-2-amino-5-(2-methylpyrrolidin-1-yl)-5-oxopentanoic acid (PubChem CID 139553940) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is (2R)-2-amino-5-(2-methylpyrrolidin-1-yl)-5-oxopentanoic acid.
| Compound Name | (2R)-2-amino-5-(2-methylpyrrolidin-1-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139553940 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | (2R)-2-amino-5-(2-methylpyrrolidin-1-yl)-5-oxopentanoic acid |
| SMILES | CC1CCCN1C(=O)CC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C10H18N2O3/c1-7-3-2-6-12(7)9(13)5-4-8(11)10(14)15/h7-8H,2-6,11H2,1H3,(H,14,15)/t7?,8-/m1/s1 |
| InChIKey | SVQSULFSUZNVDV-BRFYHDHCSA-N |
| XLogP | 0.19 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |