C15H28N2O2 — CID 59576434
(2S)-2-amino-1-[(2R)-2-methylpyrrolidin-1-yl]decane-1,8-dione (PubChem CID 59576434) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2S)-2-amino-1-[(2R)-2-methylpyrrolidin-1-yl]decane-1,8-dione.
| Compound Name | (2S)-2-amino-1-[(2R)-2-methylpyrrolidin-1-yl]decane-1,8-dione |
|---|---|
| PubChem CID | 59576434 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (2S)-2-amino-1-[(2R)-2-methylpyrrolidin-1-yl]decane-1,8-dione |
| SMILES | CCC(=O)CCCCC[C@H](N)C(=O)N1CCC[C@H]1C |
| InChI | InChI=1S/C15H28N2O2/c1-3-13(18)9-5-4-6-10-14(16)15(19)17-11-7-8-12(17)2/h12,14H,3-11,16H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | JULXIBAAFXXOGT-OCCSQVGLSA-N |
| XLogP | 2.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|