C45H74N6O8 — CID 139554876
9-benzyl-6,18-dihexyl-3,4,10,16-tetramethyl-12,15-bis(2-methylpropyl)-1-oxa-4,7,10,13,16,19-hexazacyclohenicosane-2,5,8,11,14,17,20-heptone (PubChem CID 139554876) has the molecular formula C45H74N6O8 and a molecular weight of 827.12 g/mol. Its IUPAC name is 9-benzyl-6,18-dihexyl-3,4,10,16-tetramethyl-12,15-bis(2-methylpropyl)-1-oxa-4,7,10,13,16,19-hexazacyclohenicosane-2,5,8,11,14,17,20-heptone.
| Compound Name | 9-benzyl-6,18-dihexyl-3,4,10,16-tetramethyl-12,15-bis(2-methylpropyl)-1-oxa-4,7,10,13,16,19-hexazacyclohenicosane-2,5,8,11,14,17,20-heptone |
|---|---|
| PubChem CID | 139554876 |
| Molecular Formula | C45H74N6O8 |
| Molecular Weight | 827.12 g/mol |
| Exact Mass | 826.56 |
| IUPAC Name | 9-benzyl-6,18-dihexyl-3,4,10,16-tetramethyl-12,15-bis(2-methylpropyl)-1-oxa-4,7,10,13,16,19-hexazacyclohenicosane-2,5,8,11,14,17,20-heptone |
| SMILES | CCCCCCC1NC(=O)C(Cc2ccccc2)N(C)C(=O)C(CC(C)C)NC(=O)C(CC(C)C)N(C)C(=O)C(CCCCCC)NC(=O)COC(=O)C(C)N(C)C1=O |
| InChI | InChI=1S/C45H74N6O8/c1-11-13-15-20-24-34-43(56)50(9)37(27-31(5)6)40(53)48-36(26-30(3)4)44(57)51(10)38(28-33-22-18-17-19-23-33)41(54)47-35(25-21-16-14-12-2)42(55)49(8)32(7)45(58)59-29-39(52)46-34/h17-19,22-23,30-32,34-38H,11-16,20-21,24-29H2,1-10H3,(H,46,52)(H,47,54)(H,48,53) |
| InChIKey | OIXOLQAYJIWZNX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 174.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.12 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|