C35H43FN6O4 — CID 139555511
N-cyclohexyl-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]-1-methylpyrazole-4-carboxamide (PubChem CID 139555511) has the molecular formula C35H43FN6O4 and a molecular weight of 630.77 g/mol. Its IUPAC name is N-cyclohexyl-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-cyclohexyl-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139555511 |
| Molecular Formula | C35H43FN6O4 |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | N-cyclohexyl-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]-1-methylpyrazole-4-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(Nc4nn(C)cc4C(=O)NC4CCCCC4)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C35H43FN6O4/c1-41-23-27(35(43)39-24-10-5-3-6-11-24)34(40-41)38-25-12-13-31(28(36)20-25)46-30-14-15-37-29-22-33(32(44-2)21-26(29)30)45-19-9-18-42-16-7-4-8-17-42/h12-15,20-24H,3-11,16-19H2,1-2H3,(H,38,40)(H,39,43) |
| InChIKey | IWCJSZNTVTVXGA-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|