C29H37NO4 — CID 139557142
[(4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] 3-cyclopentylpropanoate (PubChem CID 139557142) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is [(4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] 3-cyclopentylpropanoate.
| Compound Name | [(4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 139557142 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | [(4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] 3-cyclopentylpropanoate |
| SMILES | C=C1CC[C@@]2(O)C3Cc4ccc(OC(=O)CCC5CCCC5)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C29H37NO4/c1-18-12-13-29(32)23-16-21-9-10-22(33-24(31)11-8-19-4-2-3-5-19)26-25(21)28(29,27(18)34-26)14-15-30(23)17-20-6-7-20/h9-10,19-20,23,27,32H,1-8,11-17H2/t23?,27-,28-,29+/m0/s1 |
| InChIKey | WVNSOTCOFPQZTD-PCYNRASCSA-N |
| XLogP | 4.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|