C19H19F4N3O2 — CID 139557382
1-[1-[6-[3-fluoro-4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-4-yl]propan-2-one (PubChem CID 139557382) has the molecular formula C19H19F4N3O2 and a molecular weight of 397.37 g/mol. Its IUPAC name is 1-[1-[6-[3-fluoro-4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-4-yl]propan-2-one.
| Compound Name | 1-[1-[6-[3-fluoro-4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-4-yl]propan-2-one |
|---|---|
| PubChem CID | 139557382 |
| Molecular Formula | C19H19F4N3O2 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-[1-[6-[3-fluoro-4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-4-yl]propan-2-one |
| SMILES | CC(=O)CC1CCN(c2cc(-c3ccc(OC(F)(F)F)c(F)c3)ncn2)CC1 |
| InChI | InChI=1S/C19H19F4N3O2/c1-12(27)8-13-4-6-26(7-5-13)18-10-16(24-11-25-18)14-2-3-17(15(20)9-14)28-19(21,22)23/h2-3,9-11,13H,4-8H2,1H3 |
| InChIKey | JINYHEIBTWIZAD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |