C17H16F4N4O3 — CID 139557461
[1-[6-[3-fluoro-4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-4-yl]carbamic acid (PubChem CID 139557461) has the molecular formula C17H16F4N4O3 and a molecular weight of 400.33 g/mol. Its IUPAC name is [1-[6-[3-fluoro-4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[6-[3-fluoro-4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 139557461 |
| Molecular Formula | C17H16F4N4O3 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [1-[6-[3-fluoro-4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(c2cc(-c3ccc(OC(F)(F)F)c(F)c3)ncn2)CC1 |
| InChI | InChI=1S/C17H16F4N4O3/c18-12-7-10(1-2-14(12)28-17(19,20)21)13-8-15(23-9-22-13)25-5-3-11(4-6-25)24-16(26)27/h1-2,7-9,11,24H,3-6H2,(H,26,27) |
| InChIKey | UFCXNOOFTAJUSA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |