C16H25N3 — CID 139557415
1-tert-butyl-3,5-dimethylpyrazole;phenylmethanamine (PubChem CID 139557415) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethylpyrazole;phenylmethanamine.
| Compound Name | 1-tert-butyl-3,5-dimethylpyrazole;phenylmethanamine |
|---|---|
| PubChem CID | 139557415 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-tert-butyl-3,5-dimethylpyrazole;phenylmethanamine |
| SMILES | Cc1cc(C)n(C(C)(C)C)n1.NCc1ccccc1 |
| InChI | InChI=1S/C9H16N2.C7H9N/c1-7-6-8(2)11(10-7)9(3,4)5;8-6-7-4-2-1-3-5-7/h6H,1-5H3;1-5H,6,8H2 |
| InChIKey | WYIKGITYFQHZEE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |