C15H16ClFN2O3S — CID 139557901
4-[[5-[2-chloro-4-(2-fluoropropan-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid (PubChem CID 139557901) has the molecular formula C15H16ClFN2O3S and a molecular weight of 358.82 g/mol. Its IUPAC name is 4-[[5-[2-chloro-4-(2-fluoropropan-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid.
| Compound Name | 4-[[5-[2-chloro-4-(2-fluoropropan-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 139557901 |
| Molecular Formula | C15H16ClFN2O3S |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-[[5-[2-chloro-4-(2-fluoropropan-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
| SMILES | CC(C)(F)c1ccc(-c2nnc(SCCCC(=O)O)o2)c(Cl)c1 |
| InChI | InChI=1S/C15H16ClFN2O3S/c1-15(2,17)9-5-6-10(11(16)8-9)13-18-19-14(22-13)23-7-3-4-12(20)21/h5-6,8H,3-4,7H2,1-2H3,(H,20,21) |
| InChIKey | CYYLCWKWZHKSKM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|