C21H27ClN4O — CID 139559947
N-(2-amino-3-ethylbenzimidazol-5-yl)-4-pentylbenzamide;hydrochloride (PubChem CID 139559947) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is N-(2-amino-3-ethylbenzimidazol-5-yl)-4-pentylbenzamide;hydrochloride.
| Compound Name | N-(2-amino-3-ethylbenzimidazol-5-yl)-4-pentylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 139559947 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-(2-amino-3-ethylbenzimidazol-5-yl)-4-pentylbenzamide;hydrochloride |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc3nc(N)n(CC)c3c2)cc1.Cl |
| InChI | InChI=1S/C21H26N4O.ClH/c1-3-5-6-7-15-8-10-16(11-9-15)20(26)23-17-12-13-18-19(14-17)25(4-2)21(22)24-18;/h8-14H,3-7H2,1-2H3,(H2,22,24)(H,23,26);1H |
| InChIKey | PRFPUXWTPFHBMG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|