C22H29NO4S — CID 139945331
2-methyl-4-[(4-octylbenzoyl)amino]benzenesulfonic acid (PubChem CID 139945331) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is 2-methyl-4-[(4-octylbenzoyl)amino]benzenesulfonic acid.
| Compound Name | 2-methyl-4-[(4-octylbenzoyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 139945331 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-methyl-4-[(4-octylbenzoyl)amino]benzenesulfonic acid |
| SMILES | CCCCCCCCc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c(C)c2)cc1 |
| InChI | InChI=1S/C22H29NO4S/c1-3-4-5-6-7-8-9-18-10-12-19(13-11-18)22(24)23-20-14-15-21(17(2)16-20)28(25,26)27/h10-16H,3-9H2,1-2H3,(H,23,24)(H,25,26,27) |
| InChIKey | SJYIXKXGFKJFLD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|