C17H18FNO4S — CID 139946902
5-[(4-butylbenzoyl)amino]-2-fluorobenzenesulfonic acid (PubChem CID 139946902) has the molecular formula C17H18FNO4S and a molecular weight of 351.40 g/mol. Its IUPAC name is 5-[(4-butylbenzoyl)amino]-2-fluorobenzenesulfonic acid.
| Compound Name | 5-[(4-butylbenzoyl)amino]-2-fluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 139946902 |
| Molecular Formula | C17H18FNO4S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 5-[(4-butylbenzoyl)amino]-2-fluorobenzenesulfonic acid |
| SMILES | CCCCc1ccc(C(=O)Nc2ccc(F)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H18FNO4S/c1-2-3-4-12-5-7-13(8-6-12)17(20)19-14-9-10-15(18)16(11-14)24(21,22)23/h5-11H,2-4H2,1H3,(H,19,20)(H,21,22,23) |
| InChIKey | QQZCXIFASOFGFM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|