C13H8Br2FNO4S — CID 139946863
5-[(3,5-dibromobenzoyl)amino]-2-fluorobenzenesulfonic acid (PubChem CID 139946863) has the molecular formula C13H8Br2FNO4S and a molecular weight of 453.08 g/mol. Its IUPAC name is 5-[(3,5-dibromobenzoyl)amino]-2-fluorobenzenesulfonic acid.
| Compound Name | 5-[(3,5-dibromobenzoyl)amino]-2-fluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 139946863 |
| Molecular Formula | C13H8Br2FNO4S |
| Molecular Weight | 453.08 g/mol |
| Exact Mass | 450.85 |
| IUPAC Name | 5-[(3,5-dibromobenzoyl)amino]-2-fluorobenzenesulfonic acid |
| SMILES | O=C(Nc1ccc(F)c(S(=O)(=O)O)c1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H8Br2FNO4S/c14-8-3-7(4-9(15)5-8)13(18)17-10-1-2-11(16)12(6-10)22(19,20)21/h1-6H,(H,17,18)(H,19,20,21) |
| InChIKey | VXVYMICNUNOHIO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.08 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|